C34H38O4 — CID 122679904
(4aS,5S,5aR,6R,12aS)-2-acetyl-10-hydroxy-3,4a,5a,6,12,12a-hexamethyl-5-(2-phenylethyl)-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 122679904) has the molecular formula C34H38O4 and a molecular weight of 510.67 g/mol. Its IUPAC name is (4aS,5S,5aR,6R,12aS)-2-acetyl-10-hydroxy-3,4a,5a,6,12,12a-hexamethyl-5-(2-phenylethyl)-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | (4aS,5S,5aR,6R,12aS)-2-acetyl-10-hydroxy-3,4a,5a,6,12,12a-hexamethyl-5-(2-phenylethyl)-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 122679904 |
| Molecular Formula | C34H38O4 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (4aS,5S,5aR,6R,12aS)-2-acetyl-10-hydroxy-3,4a,5a,6,12,12a-hexamethyl-5-(2-phenylethyl)-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)C[C@@]2(C)[C@H](CCc3ccccc3)[C@]3(C)C(=C(C)[C@@]2(C)C1=O)C(=O)c1c(O)cccc1[C@H]3C |
| InChI | InChI=1S/C34H38O4/c1-19-18-32(5)26(17-16-23-12-9-8-10-13-23)33(6)20(2)24-14-11-15-25(36)28(24)30(37)29(33)21(3)34(32,7)31(38)27(19)22(4)35/h8-15,20,26,36H,16-18H2,1-7H3/t20-,26+,32+,33-,34+/m1/s1 |
| InChIKey | MDJKKJPYOWKNQC-CEOOXZBMSA-N |
| XLogP | 7.17 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|