C54H54F2N4S5 — CID 122679977
4,9-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 122679977) has the molecular formula C54H54F2N4S5 and a molecular weight of 957.39 g/mol. Its IUPAC name is 4,9-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 122679977 |
| Molecular Formula | C54H54F2N4S5 |
| Molecular Weight | 957.39 g/mol |
| Exact Mass | 956.29 |
| IUPAC Name | 4,9-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCC(CC)CCc1ccc(-c2ccc(-c3c4nsnc4c(-c4ccc(-c5ccc(CCC(CC)CCCC)cc5F)s4)c4nc(-c5cccs5)c(-c5cccs5)nc34)s2)c(F)c1 |
| InChI | InChI=1S/C54H54F2N4S5/c1-5-9-13-33(7-3)17-19-35-21-23-37(39(55)31-35)41-25-27-43(63-41)47-51-52(58-50(46-16-12-30-62-46)49(57-51)45-15-11-29-61-45)48(54-53(47)59-65-60-54)44-28-26-42(64-44)38-24-22-36(32-40(38)56)20-18-34(8-4)14-10-6-2/h11-12,15-16,21-34H,5-10,13-14,17-20H2,1-4H3 |
| InChIKey | QEHQQUKQOMKLFZ-UHFFFAOYSA-N |
| XLogP | 18.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.39 |
| LogP ≤ 5 | 18.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |