C40H36F4N4O2S3 — CID 122679979
4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-diethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 122679979) has the molecular formula C40H36F4N4O2S3 and a molecular weight of 776.95 g/mol. Its IUPAC name is 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-diethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-diethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 122679979 |
| Molecular Formula | C40H36F4N4O2S3 |
| Molecular Weight | 776.95 g/mol |
| Exact Mass | 776.19 |
| IUPAC Name | 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-diethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCC(F)(F)Oc1ccc(-c2ccc(-c3c4nsnc4c(-c4ccc(-c5ccc(OC(F)(F)CCC)cc5)s4)c4nc(CC)c(CC)nc34)s2)cc1 |
| InChI | InChI=1S/C40H36F4N4O2S3/c1-5-21-39(41,42)49-25-13-9-23(10-14-25)29-17-19-31(51-29)33-35-36(46-28(8-4)27(7-3)45-35)34(38-37(33)47-53-48-38)32-20-18-30(52-32)24-11-15-26(16-12-24)50-40(43,44)22-6-2/h9-20H,5-8,21-22H2,1-4H3 |
| InChIKey | CDSLOLSJBMGEIN-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.95 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |