C38H32F4N4O2S3 — CID 122679993
4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 122679993) has the molecular formula C38H32F4N4O2S3 and a molecular weight of 748.89 g/mol. Its IUPAC name is 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 122679993 |
| Molecular Formula | C38H32F4N4O2S3 |
| Molecular Weight | 748.89 g/mol |
| Exact Mass | 748.16 |
| IUPAC Name | 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCC(F)(F)Oc1ccc(-c2ccc(-c3c4nsnc4c(-c4ccc(-c5ccc(OC(F)(F)CCC)cc5)s4)c4nc(C)c(C)nc34)s2)cc1 |
| InChI | InChI=1S/C38H32F4N4O2S3/c1-5-19-37(39,40)47-25-11-7-23(8-12-25)27-15-17-29(49-27)31-33-34(44-22(4)21(3)43-33)32(36-35(31)45-51-46-36)30-18-16-28(50-30)24-9-13-26(14-10-24)48-38(41,42)20-6-2/h7-18H,5-6,19-20H2,1-4H3 |
| InChIKey | UWEYHSLNEZTJCL-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.89 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |