C50H56F2N4S3 — CID 122680100
4,11-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-b]phenazine (PubChem CID 122680100) has the molecular formula C50H56F2N4S3 and a molecular weight of 847.22 g/mol. Its IUPAC name is 4,11-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-b]phenazine.
| Compound Name | 4,11-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-b]phenazine |
|---|---|
| PubChem CID | 122680100 |
| Molecular Formula | C50H56F2N4S3 |
| Molecular Weight | 847.22 g/mol |
| Exact Mass | 846.36 |
| IUPAC Name | 4,11-bis[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-b]phenazine |
| SMILES | CCCCC(CC)CCc1ccc(-c2ccc(-c3c4nsnc4c(-c4ccc(-c5ccc(CCC(CC)CCCC)cc5F)s4)c4nc5c(nc34)CCCC5)s2)c(F)c1 |
| InChI | InChI=1S/C50H56F2N4S3/c1-5-9-13-31(7-3)17-19-33-21-23-35(37(51)29-33)41-25-27-43(57-41)45-47-48(54-40-16-12-11-15-39(40)53-47)46(50-49(45)55-59-56-50)44-28-26-42(58-44)36-24-22-34(30-38(36)52)20-18-32(8-4)14-10-6-2/h21-32H,5-20H2,1-4H3 |
| InChIKey | MOGWIQRNEXOFNB-UHFFFAOYSA-N |
| XLogP | 15.88 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.22 |
| LogP ≤ 5 | 15.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |