C36H40O6 — CID 122680119
propyl 2-[4-[(6aS,10aS,11aS)-8-acetyl-4-hydroxy-6,6a,9,10a,11a-pentamethyl-5,7-dioxo-11,12-dihydro-10H-tetracen-1-yl]phenyl]acetate (PubChem CID 122680119) has the molecular formula C36H40O6 and a molecular weight of 568.71 g/mol. Its IUPAC name is propyl 2-[4-[(6aS,10aS,11aS)-8-acetyl-4-hydroxy-6,6a,9,10a,11a-pentamethyl-5,7-dioxo-11,12-dihydro-10H-tetracen-1-yl]phenyl]acetate.
| Compound Name | propyl 2-[4-[(6aS,10aS,11aS)-8-acetyl-4-hydroxy-6,6a,9,10a,11a-pentamethyl-5,7-dioxo-11,12-dihydro-10H-tetracen-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 122680119 |
| Molecular Formula | C36H40O6 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | propyl 2-[4-[(6aS,10aS,11aS)-8-acetyl-4-hydroxy-6,6a,9,10a,11a-pentamethyl-5,7-dioxo-11,12-dihydro-10H-tetracen-1-yl]phenyl]acetate |
| SMILES | CCCOC(=O)Cc1ccc(-c2ccc(O)c3c2C[C@]2(C)C[C@]4(C)CC(C)=C(C(C)=O)C(=O)[C@]4(C)C(C)=C2C3=O)cc1 |
| InChI | InChI=1S/C36H40O6/c1-8-15-42-28(39)16-23-9-11-24(12-10-23)25-13-14-27(38)30-26(25)18-34(5)19-35(6)17-20(2)29(22(4)37)33(41)36(35,7)21(3)31(34)32(30)40/h9-14,38H,8,15-19H2,1-7H3/t34-,35+,36+/m1/s1 |
| InChIKey | FFDPNMOITYHHCF-SBPNQFBHSA-N |
| XLogP | 6.91 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|