C34H38O7 — CID 122680134
(4aR,11aS,12aS)-3-acetyl-10-[4-(3,3-dimethylbutyl)phenyl]-4,4a,6,7-tetrahydroxy-11a,12a-dimethyl-11,12-dihydro-1H-tetracene-2,5-dione (PubChem CID 122680134) has the molecular formula C34H38O7 and a molecular weight of 558.67 g/mol. Its IUPAC name is (4aR,11aS,12aS)-3-acetyl-10-[4-(3,3-dimethylbutyl)phenyl]-4,4a,6,7-tetrahydroxy-11a,12a-dimethyl-11,12-dihydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11aS,12aS)-3-acetyl-10-[4-(3,3-dimethylbutyl)phenyl]-4,4a,6,7-tetrahydroxy-11a,12a-dimethyl-11,12-dihydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 122680134 |
| Molecular Formula | C34H38O7 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | (4aR,11aS,12aS)-3-acetyl-10-[4-(3,3-dimethylbutyl)phenyl]-4,4a,6,7-tetrahydroxy-11a,12a-dimethyl-11,12-dihydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(CCC(C)(C)C)cc5)c4C[C@@]3(C)C[C@@]2(C)CC1=O |
| InChI | InChI=1S/C34H38O7/c1-18(35)25-24(37)16-33(6)17-32(5)15-22-21(20-9-7-19(8-10-20)13-14-31(2,3)4)11-12-23(36)26(22)28(38)27(32)30(40)34(33,41)29(25)39/h7-12,36,38-39,41H,13-17H2,1-6H3/t32-,33+,34+/m0/s1 |
| InChIKey | YMYGMVZJPJMZNN-LBFZIJHGSA-N |
| XLogP | 5.95 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|