C39H46O3 — CID 122680284
(4aS,5aS,12aS)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[4-(2-methylidenehexyl)phenyl]-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 122680284) has the molecular formula C39H46O3 and a molecular weight of 562.79 g/mol. Its IUPAC name is (4aS,5aS,12aS)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[4-(2-methylidenehexyl)phenyl]-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | (4aS,5aS,12aS)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[4-(2-methylidenehexyl)phenyl]-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 122680284 |
| Molecular Formula | C39H46O3 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | (4aS,5aS,12aS)-2-acetyl-3,4a,5a,10,12,12a-hexamethyl-7-[4-(2-methylidenehexyl)phenyl]-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | C=C(CCCC)Cc1ccc(-c2ccc(C)c3c2C[C@]2(C)C[C@]4(C)CC(C)=C(C(C)=O)C(=O)[C@]4(C)C(C)=C2C3=O)cc1 |
| InChI | InChI=1S/C39H46O3/c1-10-11-12-23(2)19-28-14-16-29(17-15-28)30-18-13-24(3)33-31(30)21-37(7)22-38(8)20-25(4)32(27(6)40)36(42)39(38,9)26(5)34(37)35(33)41/h13-18H,2,10-12,19-22H2,1,3-9H3/t37-,38+,39+/m1/s1 |
| InChIKey | QMBGNBCKTLVBEA-VFBMNZBOSA-N |
| XLogP | 9.31 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|