C38H52O — CID 122680311
(4aR,11aR,12aS)-2,5,7,11a,12a-pentamethyl-8-(4-methylcyclohexyl)-4,6-dimethylidene-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracen-4a-ol (PubChem CID 122680311) has the molecular formula C38H52O and a molecular weight of 524.83 g/mol. Its IUPAC name is (4aR,11aR,12aS)-2,5,7,11a,12a-pentamethyl-8-(4-methylcyclohexyl)-4,6-dimethylidene-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracen-4a-ol.
| Compound Name | (4aR,11aR,12aS)-2,5,7,11a,12a-pentamethyl-8-(4-methylcyclohexyl)-4,6-dimethylidene-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracen-4a-ol |
|---|---|
| PubChem CID | 122680311 |
| Molecular Formula | C38H52O |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | (4aR,11aR,12aS)-2,5,7,11a,12a-pentamethyl-8-(4-methylcyclohexyl)-4,6-dimethylidene-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracen-4a-ol |
| SMILES | C=C(C)C1=C(C)C[C@@]2(C)C[C@@]3(C)Cc4c(C(C)C)cc(C5CCC(C)CC5)c(C)c4C(=C)C3=C(C)[C@@]2(O)C1=C |
| InChI | InChI=1S/C38H52O/c1-21(2)30-17-31(29-15-13-23(5)14-16-29)25(7)34-26(8)35-28(10)38(39)27(9)33(22(3)4)24(6)18-37(38,12)20-36(35,11)19-32(30)34/h17,21,23,29,39H,3,8-9,13-16,18-20H2,1-2,4-7,10-12H3/t23?,29?,36-,37+,38+/m1/s1 |
| InChIKey | YFUXLOSSJIXSRO-GKTRCSMZSA-N |
| XLogP | 10.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |