C37H52O3 — CID 122680320
(6aS,10aS,11aS)-8-acetyl-3-(4-ethylhexyl)-4-hydroxy-6,6a,9,10a,11a-pentamethyl-7-methylidene-1-propan-2-yl-11,12-dihydro-10H-tetracen-5-one (PubChem CID 122680320) has the molecular formula C37H52O3 and a molecular weight of 544.82 g/mol. Its IUPAC name is (6aS,10aS,11aS)-8-acetyl-3-(4-ethylhexyl)-4-hydroxy-6,6a,9,10a,11a-pentamethyl-7-methylidene-1-propan-2-yl-11,12-dihydro-10H-tetracen-5-one.
| Compound Name | (6aS,10aS,11aS)-8-acetyl-3-(4-ethylhexyl)-4-hydroxy-6,6a,9,10a,11a-pentamethyl-7-methylidene-1-propan-2-yl-11,12-dihydro-10H-tetracen-5-one |
|---|---|
| PubChem CID | 122680320 |
| Molecular Formula | C37H52O3 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | (6aS,10aS,11aS)-8-acetyl-3-(4-ethylhexyl)-4-hydroxy-6,6a,9,10a,11a-pentamethyl-7-methylidene-1-propan-2-yl-11,12-dihydro-10H-tetracen-5-one |
| SMILES | C=C1C(C(C)=O)=C(C)C[C@@]2(C)C[C@@]3(C)Cc4c(C(C)C)cc(CCCC(CC)CC)c(O)c4C(=O)C3=C(C)[C@@]12C |
| InChI | InChI=1S/C37H52O3/c1-12-26(13-2)15-14-16-27-17-28(21(3)4)29-19-35(9)20-36(10)18-22(5)30(25(8)38)23(6)37(36,11)24(7)32(35)34(40)31(29)33(27)39/h17,21,26,39H,6,12-16,18-20H2,1-5,7-11H3/t35-,36+,37-/m1/s1 |
| InChIKey | SZKPNQFDCHWKDO-HPJTWKJOSA-N |
| XLogP | 9.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |