C32H40O8 — CID 122680455
2,2-dimethylpropyl 2-[(5aR,6aS,10aR)-9-acetyl-4-ethyl-1,10a,12-trihydroxy-5a,6a,8-trimethyl-10,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]acetate (PubChem CID 122680455) has the molecular formula C32H40O8 and a molecular weight of 552.66 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[(5aR,6aS,10aR)-9-acetyl-4-ethyl-1,10a,12-trihydroxy-5a,6a,8-trimethyl-10,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]acetate.
| Compound Name | 2,2-dimethylpropyl 2-[(5aR,6aS,10aR)-9-acetyl-4-ethyl-1,10a,12-trihydroxy-5a,6a,8-trimethyl-10,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]acetate |
|---|---|
| PubChem CID | 122680455 |
| Molecular Formula | C32H40O8 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 2,2-dimethylpropyl 2-[(5aR,6aS,10aR)-9-acetyl-4-ethyl-1,10a,12-trihydroxy-5a,6a,8-trimethyl-10,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]acetate |
| SMILES | CCc1cc(CC(=O)OCC(C)(C)C)c(O)c2c1C[C@]1(C)C[C@]3(C)CC(C)=C(C(C)=O)C(=O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H40O8/c1-9-18-10-19(11-21(34)40-15-29(4,5)6)25(35)23-20(18)13-30(7)14-31(8)12-16(2)22(17(3)33)27(37)32(31,39)28(38)24(30)26(23)36/h10,35-36,39H,9,11-15H2,1-8H3/t30-,31+,32+/m1/s1 |
| InChIKey | ZNARODKADCQXRO-RTOKGZNSSA-N |
| XLogP | 4.51 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|