C42H52O2 — CID 122680578
(6aS,10aS,11aS)-4,6,6a,9,10a,11a-hexamethyl-7-methylidene-3-[3-(4-methylphenoxy)but-3-enyl]-1-propan-2-yl-8-prop-1-en-2-yl-11,12-dihydro-10H-tetracen-5-one (PubChem CID 122680578) has the molecular formula C42H52O2 and a molecular weight of 588.88 g/mol. Its IUPAC name is (6aS,10aS,11aS)-4,6,6a,9,10a,11a-hexamethyl-7-methylidene-3-[3-(4-methylphenoxy)but-3-enyl]-1-propan-2-yl-8-prop-1-en-2-yl-11,12-dihydro-10H-tetracen-5-one.
| Compound Name | (6aS,10aS,11aS)-4,6,6a,9,10a,11a-hexamethyl-7-methylidene-3-[3-(4-methylphenoxy)but-3-enyl]-1-propan-2-yl-8-prop-1-en-2-yl-11,12-dihydro-10H-tetracen-5-one |
|---|---|
| PubChem CID | 122680578 |
| Molecular Formula | C42H52O2 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | (6aS,10aS,11aS)-4,6,6a,9,10a,11a-hexamethyl-7-methylidene-3-[3-(4-methylphenoxy)but-3-enyl]-1-propan-2-yl-8-prop-1-en-2-yl-11,12-dihydro-10H-tetracen-5-one |
| SMILES | C=C(CCc1cc(C(C)C)c2c(c1C)C(=O)C1=C(C)[C@@]3(C)C(=C)C(C(=C)C)=C(C)C[C@@]3(C)C[C@@]1(C)C2)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C42H52O2/c1-24(2)34-20-32(17-16-28(7)44-33-18-14-26(5)15-19-33)29(8)37-35(34)22-40(11)23-41(12)21-27(6)36(25(3)4)30(9)42(41,13)31(10)38(40)39(37)43/h14-15,18-20,24H,3,7,9,16-17,21-23H2,1-2,4-6,8,10-13H3/t40-,41+,42-/m1/s1 |
| InChIKey | QBDBJXLOLNKSFK-BMBFPDSCSA-N |
| XLogP | 11.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|