About 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol
1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol (PubChem CID 122680924) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol.
Molecular Properties
| Compound Name | 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol |
| PubChem CID | 122680924 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol |
| SMILES | CC(C)=C/C=C\CNC(C)O |
| InChI | InChI=1S/C9H17NO/c1-8(2)6-4-5-7-10-9(3)11/h4-6,9-11H,7H2,1-3H3/b5-4- |
| InChIKey | TXHBMYYZISYFDA-PLNGDYQASA-N |
| XLogP | 1.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol?
The IUPAC name of 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol (CID 122680924) is 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol.
What is the SMILES notation for 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol?
The canonical SMILES for 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol is CC(C)=C/C=C\CNC(C)O.
What is the InChIKey of 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol?
The InChIKey is TXHBMYYZISYFDA-PLNGDYQASA-N. The full InChI is InChI=1S/C9H17NO/c1-8(2)6-4-5-7-10-9(3)11/h4-6,9-11H,7H2,1-3H3/b5-4-.
What are the key properties of 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol?
1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol has a molecular weight of 155.24 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2Z)-5-methylhexa-2,4-dienyl]amino]ethanol is sourced from PubChem (CID 122680924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).