C7H12ClN3 — CID 122681135
2-chloro-N,N,4-trimethyl-1,4-dihydropyrimidin-6-amine (PubChem CID 122681135) has the molecular formula C7H12ClN3 and a molecular weight of 173.65 g/mol. Its IUPAC name is 2-chloro-N,N,4-trimethyl-1,4-dihydropyrimidin-6-amine.
| Compound Name | 2-chloro-N,N,4-trimethyl-1,4-dihydropyrimidin-6-amine |
|---|---|
| PubChem CID | 122681135 |
| Molecular Formula | C7H12ClN3 |
| Molecular Weight | 173.65 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-chloro-N,N,4-trimethyl-1,4-dihydropyrimidin-6-amine |
| SMILES | CC1C=C(N(C)C)NC(Cl)=N1 |
| InChI | InChI=1S/C7H12ClN3/c1-5-4-6(11(2)3)10-7(8)9-5/h4-5H,1-3H3,(H,9,10) |
| InChIKey | YMWHAZYSZQRRKU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.65 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|