C28H29FN4O6S2 — CID 122682085
2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenylmethoxyethylamino)ethyl]acetamide (PubChem CID 122682085) has the molecular formula C28H29FN4O6S2 and a molecular weight of 600.69 g/mol. Its IUPAC name is 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenylmethoxyethylamino)ethyl]acetamide.
| Compound Name | 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenylmethoxyethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 122682085 |
| Molecular Formula | C28H29FN4O6S2 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenylmethoxyethylamino)ethyl]acetamide |
| SMILES | COCCS(=O)(=O)C(C(=O)NCC(=O)NCCOCc1ccccc1)c1nc2ccc(-c3ccc(F)nc3)cc2s1 |
| InChI | InChI=1S/C28H29FN4O6S2/c1-38-13-14-41(36,37)26(27(35)32-17-25(34)30-11-12-39-18-19-5-3-2-4-6-19)28-33-22-9-7-20(15-23(22)40-28)21-8-10-24(29)31-16-21/h2-10,15-16,26H,11-14,17-18H2,1H3,(H,30,34)(H,32,35) |
| InChIKey | PYWVZXOLJLOTFY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|