C29H35N3O7S — CID 122683017
(E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-1-ene-1-sulfonamide (PubChem CID 122683017) has the molecular formula C29H35N3O7S and a molecular weight of 569.68 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 122683017 |
| Molecular Formula | C29H35N3O7S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(diethylamino)naphthalen-2-yl]furan-2-yl]-N-[(3R,4R,5S,6R)-6-ethyl-2,4,5-trihydroxyoxan-3-yl]prop-1-ene-1-sulfonamide |
| SMILES | CC[C@H]1OC(O)[C@H](NS(=O)(=O)/C(C#N)=C(\C)c2ccc(-c3ccc4cc(N(CC)CC)ccc4c3)o2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H35N3O7S/c1-5-22-27(33)28(34)26(29(35)39-22)31-40(36,37)25(16-30)17(4)23-12-13-24(38-23)20-9-8-19-15-21(32(6-2)7-3)11-10-18(19)14-20/h8-15,22,26-29,31,33-35H,5-7H2,1-4H3/b25-17+/t22-,26-,27-,28-,29?/m1/s1 |
| InChIKey | RIJNYPZGXVTVBN-WJYLLUBOSA-N |
| XLogP | 3.34 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|