C11H22NO6P — CID 122683371
tert-butyl (2S)-4-methyl-2-(phosphonooxymethyl)pyrrolidine-1-carboxylate (PubChem CID 122683371) has the molecular formula C11H22NO6P and a molecular weight of 295.27 g/mol. Its IUPAC name is tert-butyl (2S)-4-methyl-2-(phosphonooxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-methyl-2-(phosphonooxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122683371 |
| Molecular Formula | C11H22NO6P |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | tert-butyl (2S)-4-methyl-2-(phosphonooxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC1C[C@@H](COP(=O)(O)O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H22NO6P/c1-8-5-9(7-17-19(14,15)16)12(6-8)10(13)18-11(2,3)4/h8-9H,5-7H2,1-4H3,(H2,14,15,16)/t8?,9-/m0/s1 |
| InChIKey | HDCSXUWFWXODAY-GKAPJAKFSA-N |
| XLogP | 1.74 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|