C26H24F2N6O2 — CID 122683478
N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyrazine-3-carboxamide (PubChem CID 122683478) has the molecular formula C26H24F2N6O2 and a molecular weight of 490.51 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyrazine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 122683478 |
| Molecular Formula | C26H24F2N6O2 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-6-oxo-1H-pyrazine-3-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(CN(CCC#N)C(=O)c1c[nH]c(=O)cn1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H24F2N6O2/c1-25(2)16-7-8-26(25,14-34(10-4-9-29)24(36)20-12-31-21(35)13-30-20)23-15(16)11-19(32-33-23)22-17(27)5-3-6-18(22)28/h3,5-6,11-13,16H,4,7-8,10,14H2,1-2H3,(H,31,35)/t16-,26-/m0/s1 |
| InChIKey | WRYQUJIDXVUHBF-QMTYFTJSSA-N |
| XLogP | 3.72 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |