About 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine
2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine (PubChem CID 122684100) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine |
| PubChem CID | 122684100 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine |
| SMILES | Cc1nc(C)c(C2OCCO2)nc1C |
| InChI | InChI=1S/C10H14N2O2/c1-6-7(2)12-9(8(3)11-6)10-13-4-5-14-10/h10H,4-5H2,1-3H3 |
| InChIKey | BNPHWBONGYEJMM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine?
The IUPAC name of 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine (CID 122684100) is 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine.
What is the SMILES notation for 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine?
The canonical SMILES for 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine is Cc1nc(C)c(C2OCCO2)nc1C.
What is the InChIKey of 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine?
The InChIKey is BNPHWBONGYEJMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-6-7(2)12-9(8(3)11-6)10-13-4-5-14-10/h10H,4-5H2,1-3H3.
What are the key properties of 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine?
2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine has a molecular weight of 194.23 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-yl)-3,5,6-trimethylpyrazine is sourced from PubChem (CID 122684100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).