About [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate
[6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate (PubChem CID 122684421) has the molecular formula C18H11ClF3NO3
and a molecular weight of 381.74 g/mol. Its IUPAC name is [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate |
| PubChem CID | 122684421 |
| Molecular Formula | C18H11ClF3NO3 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1c(CC(F)(F)F)nc2ccc(Cl)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C18H11ClF3NO3/c19-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)16(26-17(24)25)14(23-13)9-18(20,21)22/h1-8H,9H2,(H,24,25) |
| InChIKey | QKLHLOONQXENFC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate?
The IUPAC name of [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate (CID 122684421) is [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate.
What is the SMILES notation for [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate?
The canonical SMILES for [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate is O=C(O)Oc1c(CC(F)(F)F)nc2ccc(Cl)cc2c1-c1ccccc1.
What is the InChIKey of [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate?
The InChIKey is QKLHLOONQXENFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClF3NO3/c19-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)16(26-17(24)25)14(23-13)9-18(20,21)22/h1-8H,9H2,(H,24,25).
What are the key properties of [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate?
[6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate has a molecular weight of 381.74 g/mol, XLogP of 5.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-4-phenyl-2-(2,2,2-trifluoroethyl)quinolin-3-yl] hydrogen carbonate is sourced from PubChem (CID 122684421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).