C24H24O6 — CID 122685022
5-(3,4-dimethoxyphenyl)-4-methyl-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one (PubChem CID 122685022) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-methyl-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one.
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-methyl-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one |
|---|---|
| PubChem CID | 122685022 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-methyl-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one |
| SMILES | COc1ccc(-c2c(C)oc3c4c(ccc3c2=O)OC2OCCCC2C4)cc1OC |
| InChI | InChI=1S/C24H24O6/c1-13-21(14-6-8-19(26-2)20(12-14)27-3)22(25)16-7-9-18-17(23(16)29-13)11-15-5-4-10-28-24(15)30-18/h6-9,12,15,24H,4-5,10-11H2,1-3H3 |
| InChIKey | ASJXDILYEWJSRL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |