C22H18O6 — CID 122685049
5-(1,3-benzodioxol-5-yl)-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one (PubChem CID 122685049) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one |
|---|---|
| PubChem CID | 122685049 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3,11,13-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),4,8-tetraen-6-one |
| SMILES | O=c1c(-c2ccc3c(c2)OCO3)coc2c3c(ccc12)OC1OCCCC1C3 |
| InChI | InChI=1S/C22H18O6/c23-20-14-4-6-17-15(8-13-2-1-7-24-22(13)28-17)21(14)25-10-16(20)12-3-5-18-19(9-12)27-11-26-18/h3-6,9-10,13,22H,1-2,7-8,11H2 |
| InChIKey | GHPBQLYKOBKOFL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |