C18H34N4O2 — CID 122685099
N,N'-bis[(E)-propylideneamino]dodecanediamide (PubChem CID 122685099) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is N,N'-bis[(E)-propylideneamino]dodecanediamide.
| Compound Name | N,N'-bis[(E)-propylideneamino]dodecanediamide |
|---|---|
| PubChem CID | 122685099 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | N,N'-bis[(E)-propylideneamino]dodecanediamide |
| SMILES | CC/C=N/NC(=O)CCCCCCCCCCC(=O)N/N=C/CC |
| InChI | InChI=1S/C18H34N4O2/c1-3-15-19-21-17(23)13-11-9-7-5-6-8-10-12-14-18(24)22-20-16-4-2/h15-16H,3-14H2,1-2H3,(H,21,23)(H,22,24)/b19-15+,20-16+ |
| InChIKey | XKVMNMVQTZCDDX-MXWIWYRXSA-N |
| XLogP | 3.91 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|