7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride

C7H3Cl2NO3S — CID 122686239

IUPAC7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cc2ccnc(Cl)c2o1
InChIInChI=1S/C7H3Cl2NO3S/c8-7-6-4(1-2-10-7)3-5(13-6)14(9,11)12/h1-3H
InChIKeyOUJTZCMQLFGWBS-UHFFFAOYSA-N
MW252.08 g/mol
LogP2.41
Rot. Bonds1

About 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride

7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride (PubChem CID 122686239) has the molecular formula C7H3Cl2NO3S and a molecular weight of 252.08 g/mol. Its IUPAC name is 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride.

Molecular Properties

Compound Name7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride
PubChem CID122686239
Molecular FormulaC7H3Cl2NO3S
Molecular Weight252.08 g/mol
Exact Mass250.92
IUPAC Name7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cc2ccnc(Cl)c2o1
InChIInChI=1S/C7H3Cl2NO3S/c8-7-6-4(1-2-10-7)3-5(13-6)14(9,11)12/h1-3H
InChIKeyOUJTZCMQLFGWBS-UHFFFAOYSA-N
XLogP2.41
TPSA60.17 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.08
LogP ≤ 52.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride?
The IUPAC name of 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride (CID 122686239) is 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride.
What is the SMILES notation for 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride?
The canonical SMILES for 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride is O=S(=O)(Cl)c1cc2ccnc(Cl)c2o1.
What is the InChIKey of 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride?
The InChIKey is OUJTZCMQLFGWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2NO3S/c8-7-6-4(1-2-10-7)3-5(13-6)14(9,11)12/h1-3H.
What are the key properties of 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride?
7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride has a molecular weight of 252.08 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chlorofuro[2,3-c]pyridine-2-sulfonyl chloride is sourced from PubChem (CID 122686239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).