C31H31F2N9 — CID 122686339
8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5,11-bis(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686339) has the molecular formula C31H31F2N9 and a molecular weight of 567.65 g/mol. Its IUPAC name is 8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5,11-bis(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5,11-bis(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686339 |
| Molecular Formula | C31H31F2N9 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5,11-bis(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(-c4c(C)nnn4C)nc3n(C(c3ccccc3)C3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C31H31F2N9/c1-18-27(40(3)38-36-18)22-16-25-26(34-17-22)23-10-11-24(28-19(2)37-39-41(28)4)35-30(23)42(25)29(20-8-6-5-7-9-20)21-12-14-31(32,33)15-13-21/h5-11,16-17,21,29H,12-15H2,1-4H3 |
| InChIKey | OEBDFBSFMJKSFH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |