C23H20BrFN4O3 — CID 122686346
methyl 5-bromo-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate (PubChem CID 122686346) has the molecular formula C23H20BrFN4O3 and a molecular weight of 499.34 g/mol. Its IUPAC name is methyl 5-bromo-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate.
| Compound Name | methyl 5-bromo-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 122686346 |
| Molecular Formula | C23H20BrFN4O3 |
| Molecular Weight | 499.34 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | methyl 5-bromo-8-[(3-fluoro-2-pyridinyl)-(oxan-4-yl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)c1ncc(Br)cc1n2C(c1ncccc1F)C1CCOCC1 |
| InChI | InChI=1S/C23H20BrFN4O3/c1-31-23(30)14-9-16-19-18(10-15(24)12-27-19)29(22(16)28-11-14)21(13-4-7-32-8-5-13)20-17(25)3-2-6-26-20/h2-3,6,9-13,21H,4-5,7-8H2,1H3 |
| InChIKey | WTUANOKTAUYCID-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |