C26H24ClFN6O2 — CID 122686354
11-chloro-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-5-(5-methoxy-3-methyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686354) has the molecular formula C26H24ClFN6O2 and a molecular weight of 506.97 g/mol. Its IUPAC name is 11-chloro-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-5-(5-methoxy-3-methyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-chloro-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-5-(5-methoxy-3-methyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686354 |
| Molecular Formula | C26H24ClFN6O2 |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 11-chloro-8-[(S)-(2-fluorophenyl)-(oxan-4-yl)methyl]-5-(5-methoxy-3-methyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COc1nnn(C)c1-c1cnc2c3ccc(Cl)nc3n(C(c3ccccc3F)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C26H24ClFN6O2/c1-33-24(26(35-2)31-32-33)16-13-20-22(29-14-16)18-7-8-21(27)30-25(18)34(20)23(15-9-11-36-12-10-15)17-5-3-4-6-19(17)28/h3-8,13-15,23H,9-12H2,1-2H3 |
| InChIKey | YYRPBHRKSUIGDA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|