C30H31N9O — CID 122686398
5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686398) has the molecular formula C30H31N9O and a molecular weight of 533.64 g/mol. Its IUPAC name is 5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686398 |
| Molecular Formula | C30H31N9O |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 5,11-bis(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(-c4c(C)nnn4C)nc3n(C(c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C30H31N9O/c1-18-27(37(3)35-33-18)22-16-25-26(31-17-22)23-10-11-24(28-19(2)34-36-38(28)4)32-30(23)39(25)29(20-8-6-5-7-9-20)21-12-14-40-15-13-21/h5-11,16-17,21,29H,12-15H2,1-4H3 |
| InChIKey | BTPPEEJTGIIUOJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |