C27H27FN6O2 — CID 122686411
5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686411) has the molecular formula C27H27FN6O2 and a molecular weight of 486.55 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686411 |
| Molecular Formula | C27H27FN6O2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-8-[(3-fluorophenyl)-(oxan-4-yl)methyl]-10-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COc1nccc2c3ncc(-c4c(C)nnn4C)cc3n(C(c3cccc(F)c3)C3CCOCC3)c12 |
| InChI | InChI=1S/C27H27FN6O2/c1-16-24(33(2)32-31-16)19-14-22-23(30-15-19)21-7-10-29-27(35-3)26(21)34(22)25(17-8-11-36-12-9-17)18-5-4-6-20(28)13-18/h4-7,10,13-15,17,25H,8-9,11-12H2,1-3H3 |
| InChIKey | VYLXQASVZJVBMN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |