C30H32N6O2 — CID 122686425
5-(3,5-dimethyltriazol-4-yl)-11-(1-ethoxyethenyl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686425) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-11-(1-ethoxyethenyl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-11-(1-ethoxyethenyl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686425 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-11-(1-ethoxyethenyl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | C=C(OCC)c1ccc2c3ncc(-c4c(C)nnn4C)cc3n(C(c3ccccc3)C3CCOCC3)c2n1 |
| InChI | InChI=1S/C30H32N6O2/c1-5-38-20(3)25-12-11-24-27-26(17-23(18-31-27)28-19(2)33-34-35(28)4)36(30(24)32-25)29(21-9-7-6-8-10-21)22-13-15-37-16-14-22/h6-12,17-18,22,29H,3,5,13-16H2,1-2,4H3 |
| InChIKey | QAVJXNHTCMNFBU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|