C30H36N2O2S — CID 122686440
1-[4-[cyclopropylmethyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-methylphenyl]-2-hydroxy-2-phenylethanone (PubChem CID 122686440) has the molecular formula C30H36N2O2S and a molecular weight of 488.70 g/mol. Its IUPAC name is 1-[4-[cyclopropylmethyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-methylphenyl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[4-[cyclopropylmethyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-methylphenyl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 122686440 |
| Molecular Formula | C30H36N2O2S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 1-[4-[cyclopropylmethyl-(4,4,7,7-tetramethyl-5,6-dihydro-1,3-benzothiazol-2-yl)amino]-3-methylphenyl]-2-hydroxy-2-phenylethanone |
| SMILES | Cc1cc(C(=O)C(O)c2ccccc2)ccc1N(CC1CC1)c1nc2c(s1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H36N2O2S/c1-19-17-22(25(34)24(33)21-9-7-6-8-10-21)13-14-23(19)32(18-20-11-12-20)28-31-26-27(35-28)30(4,5)16-15-29(26,2)3/h6-10,13-14,17,20,24,33H,11-12,15-16,18H2,1-5H3 |
| InChIKey | FFQXWZRVRQOMHZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |