C26H25FN6O — CID 122686457
5-(3,5-dimethyltriazol-4-yl)-13-fluoro-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686457) has the molecular formula C26H25FN6O and a molecular weight of 456.53 g/mol. Its IUPAC name is 5-(3,5-dimethyltriazol-4-yl)-13-fluoro-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-(3,5-dimethyltriazol-4-yl)-13-fluoro-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686457 |
| Molecular Formula | C26H25FN6O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 5-(3,5-dimethyltriazol-4-yl)-13-fluoro-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3c(F)nccc3n(C(c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C26H25FN6O/c1-16-24(32(2)31-30-16)19-14-21-23(29-15-19)22-20(8-11-28-26(22)27)33(21)25(17-6-4-3-5-7-17)18-9-12-34-13-10-18/h3-8,11,14-15,18,25H,9-10,12-13H2,1-2H3 |
| InChIKey | AMUDQYAAKNWSBS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|