C27H25ClF2N6 — CID 122686488
11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686488) has the molecular formula C27H25ClF2N6 and a molecular weight of 506.99 g/mol. Its IUPAC name is 11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686488 |
| Molecular Formula | C27H25ClF2N6 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-5-(3,5-dimethyltriazol-4-yl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(Cl)nc3n(C(c3ccccc3)C3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C27H25ClF2N6/c1-16-24(35(2)34-33-16)19-14-21-23(31-15-19)20-8-9-22(28)32-26(20)36(21)25(17-6-4-3-5-7-17)18-10-12-27(29,30)13-11-18/h3-9,14-15,18,25H,10-13H2,1-2H3 |
| InChIKey | CYNPTXCUEXJQAB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|