C23H19BrClF2N3 — CID 122686501
5-bromo-11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122686501) has the molecular formula C23H19BrClF2N3 and a molecular weight of 490.78 g/mol. Its IUPAC name is 5-bromo-11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-bromo-11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122686501 |
| Molecular Formula | C23H19BrClF2N3 |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 5-bromo-11-chloro-8-[(4,4-difluorocyclohexyl)-phenylmethyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | FC1(F)CCC(C(c2ccccc2)n2c3cc(Br)cnc3c3ccc(Cl)nc32)CC1 |
| InChI | InChI=1S/C23H19BrClF2N3/c24-16-12-18-20(28-13-16)17-6-7-19(25)29-22(17)30(18)21(14-4-2-1-3-5-14)15-8-10-23(26,27)11-9-15/h1-7,12-13,15,21H,8-11H2 |
| InChIKey | KTINRXHJEPFEJH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|