About 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide
2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122686646) has the molecular formula C14H10BrF2N5O
and a molecular weight of 382.17 g/mol. Its IUPAC name is 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
Molecular Properties
| Compound Name | 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| PubChem CID | 122686646 |
| Molecular Formula | C14H10BrF2N5O |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | Nc1nc2c(F)c(F)cc(/C(=N/c3cccc(Br)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C14H10BrF2N5O/c15-6-2-1-3-7(4-6)19-13(22-23)8-5-9(16)10(17)12-11(8)20-14(18)21-12/h1-5,23H,(H,19,22)(H3,18,20,21) |
| InChIKey | HZKKBFRSFIBMMO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide?
The IUPAC name of 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (CID 122686646) is 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
What is the SMILES notation for 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide?
The canonical SMILES for 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide is Nc1nc2c(F)c(F)cc(/C(=N/c3cccc(Br)c3)NO)c2[nH]1.
What is the InChIKey of 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide?
The InChIKey is HZKKBFRSFIBMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2N5O/c15-6-2-1-3-7(4-6)19-13(22-23)8-5-9(16)10(17)12-11(8)20-14(18)21-12/h1-5,23H,(H,19,22)(H3,18,20,21).
What are the key properties of 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide?
2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide has a molecular weight of 382.17 g/mol, XLogP of 3.24, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-(3-bromophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide is sourced from PubChem (CID 122686646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).