C20H20ClF3N6O2 — CID 122687081
N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[2-(3-hydroxypyrrolidin-1-yl)ethylamino]-3H-benzimidazole-4-carboximidamide (PubChem CID 122687081) has the molecular formula C20H20ClF3N6O2 and a molecular weight of 468.87 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[2-(3-hydroxypyrrolidin-1-yl)ethylamino]-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[2-(3-hydroxypyrrolidin-1-yl)ethylamino]-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122687081 |
| Molecular Formula | C20H20ClF3N6O2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[2-(3-hydroxypyrrolidin-1-yl)ethylamino]-3H-benzimidazole-4-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1cc(F)c(F)c2nc(NCCN3CCC(O)C3)[nH]c12 |
| InChI | InChI=1S/C20H20ClF3N6O2/c21-13-7-10(1-2-14(13)22)26-19(29-32)12-8-15(23)16(24)18-17(12)27-20(28-18)25-4-6-30-5-3-11(31)9-30/h1-2,7-8,11,31-32H,3-6,9H2,(H,26,29)(H2,25,27,28) |
| InChIKey | ZXKOFLSFCXJVFM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|