About N-methylimidazo[4,5-b]pyridin-1-amine
N-methylimidazo[4,5-b]pyridin-1-amine (PubChem CID 122687291) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is N-methylimidazo[4,5-b]pyridin-1-amine.
Molecular Properties
| Compound Name | N-methylimidazo[4,5-b]pyridin-1-amine |
| PubChem CID | 122687291 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | N-methylimidazo[4,5-b]pyridin-1-amine |
| SMILES | CNn1cnc2ncccc21 |
| InChI | InChI=1S/C7H8N4/c1-8-11-5-10-7-6(11)3-2-4-9-7/h2-5,8H,1H3 |
| InChIKey | GTUHNEGADSEYEQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methylimidazo[4,5-b]pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylimidazo[4,5-b]pyridin-1-amine?
The IUPAC name of N-methylimidazo[4,5-b]pyridin-1-amine (CID 122687291) is N-methylimidazo[4,5-b]pyridin-1-amine.
What is the SMILES notation for N-methylimidazo[4,5-b]pyridin-1-amine?
The canonical SMILES for N-methylimidazo[4,5-b]pyridin-1-amine is CNn1cnc2ncccc21.
What is the InChIKey of N-methylimidazo[4,5-b]pyridin-1-amine?
The InChIKey is GTUHNEGADSEYEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-8-11-5-10-7-6(11)3-2-4-9-7/h2-5,8H,1H3.
What are the key properties of N-methylimidazo[4,5-b]pyridin-1-amine?
N-methylimidazo[4,5-b]pyridin-1-amine has a molecular weight of 148.17 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylimidazo[4,5-b]pyridin-1-amine is sourced from PubChem (CID 122687291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).