About CID 122687783
CID 122687783 (PubChem CID 122687783) has the molecular formula C24H35F3N7O2S-
and a molecular weight of 542.65 g/mol.
Molecular Properties
| Compound Name | CID 122687783 |
| PubChem CID | 122687783 |
| Molecular Formula | C24H35F3N7O2S- |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(C2CCC(NC3CCC4(CCNCC4)CC3)CC2)c(-c2nn[nH]n2)c1.NS(=O)[O-] |
| InChI | InChI=1S/C24H33F3N6.H3NO2S/c25-24(26,27)17-3-6-20(21(15-17)22-30-32-33-31-22)16-1-4-18(5-2-16)29-19-7-9-23(10-8-19)11-13-28-14-12-23;1-4(2)3/h3,6,15-16,18-19,28-29H,1-2,4-5,7-14H2,(H,30,31,32,33);1H2,(H,2,3)/p-1 |
| InChIKey | YEYFMHXDSJTDDW-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 122687783 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122687783?
The IUPAC name of CID 122687783 (CID 122687783) is not available.
What is the SMILES notation for CID 122687783?
The canonical SMILES for CID 122687783 is FC(F)(F)c1ccc(C2CCC(NC3CCC4(CCNCC4)CC3)CC2)c(-c2nn[nH]n2)c1.NS(=O)[O-].
What is the InChIKey of CID 122687783?
The InChIKey is YEYFMHXDSJTDDW-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H33F3N6.H3NO2S/c25-24(26,27)17-3-6-20(21(15-17)22-30-32-33-31-22)16-1-4-18(5-2-16)29-19-7-9-23(10-8-19)11-13-28-14-12-23;1-4(2)3/h3,6,15-16,18-19,28-29H,1-2,4-5,7-14H2,(H,30,31,32,33);1H2,(H,2,3)/p-1.
What are the key properties of CID 122687783?
CID 122687783 has a molecular weight of 542.65 g/mol, XLogP of 3.55, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122687783 is sourced from PubChem (CID 122687783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).