About 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid
7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid (PubChem CID 122688372) has the molecular formula C16H12FN5O2
and a molecular weight of 325.30 g/mol. Its IUPAC name is 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid |
| PubChem CID | 122688372 |
| Molecular Formula | C16H12FN5O2 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid |
| SMILES | Cc1nnn(C)c1-c1ccc2c([nH]c3cc(C(=O)O)cnc32)c1F |
| InChI | InChI=1S/C16H12FN5O2/c1-7-15(22(2)21-20-7)9-3-4-10-13-11(19-14(10)12(9)17)5-8(6-18-13)16(23)24/h3-6,19H,1-2H3,(H,23,24) |
| InChIKey | KOSFJDFFULWGOZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid?
The IUPAC name of 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid (CID 122688372) is 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid.
What is the SMILES notation for 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid?
The canonical SMILES for 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid is Cc1nnn(C)c1-c1ccc2c([nH]c3cc(C(=O)O)cnc32)c1F.
What is the InChIKey of 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid?
The InChIKey is KOSFJDFFULWGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN5O2/c1-7-15(22(2)21-20-7)9-3-4-10-13-11(19-14(10)12(9)17)5-8(6-18-13)16(23)24/h3-6,19H,1-2H3,(H,23,24).
What are the key properties of 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid?
7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid has a molecular weight of 325.30 g/mol, XLogP of 2.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,5-dimethyltriazol-4-yl)-6-fluoro-5H-pyrido[3,2-b]indole-3-carboxylic acid is sourced from PubChem (CID 122688372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).