C25H26F7N5O — CID 122688408
2-[7-(3,5-dimethyltriazol-4-yl)-9-fluoro-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol (PubChem CID 122688408) has the molecular formula C25H26F7N5O and a molecular weight of 545.50 g/mol. Its IUPAC name is 2-[7-(3,5-dimethyltriazol-4-yl)-9-fluoro-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol.
| Compound Name | 2-[7-(3,5-dimethyltriazol-4-yl)-9-fluoro-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 122688408 |
| Molecular Formula | C25H26F7N5O |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 2-[7-(3,5-dimethyltriazol-4-yl)-9-fluoro-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol |
| SMILES | Cc1nnn(C)c1-c1cc(F)c2c3ncc(C(C)(C)O)cc3n(C(CCC(F)(F)F)CCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C25H26F7N5O/c1-13-22(36(4)35-34-13)14-9-17(26)20-18(10-14)37(19-11-15(23(2,3)38)12-33-21(19)20)16(5-7-24(27,28)29)6-8-25(30,31)32/h9-12,16,38H,5-8H2,1-4H3 |
| InChIKey | AVGMHWWGZUHSRP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |