C25H27F6N5O — CID 122688443
2-[7-(3,5-dimethyltriazol-4-yl)-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol (PubChem CID 122688443) has the molecular formula C25H27F6N5O and a molecular weight of 527.51 g/mol. Its IUPAC name is 2-[7-(3,5-dimethyltriazol-4-yl)-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol.
| Compound Name | 2-[7-(3,5-dimethyltriazol-4-yl)-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 122688443 |
| Molecular Formula | C25H27F6N5O |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 2-[7-(3,5-dimethyltriazol-4-yl)-5-(1,1,1,7,7,7-hexafluoroheptan-4-yl)pyrido[3,2-b]indol-3-yl]propan-2-ol |
| SMILES | Cc1nnn(C)c1-c1ccc2c3ncc(C(C)(C)O)cc3n(C(CCC(F)(F)F)CCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C25H27F6N5O/c1-14-22(35(4)34-33-14)15-5-6-18-19(11-15)36(20-12-16(23(2,3)37)13-32-21(18)20)17(7-9-24(26,27)28)8-10-25(29,30)31/h5-6,11-13,17,37H,7-10H2,1-4H3 |
| InChIKey | ISXUTJCMNLZVSH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |