C58H54N4O4 — CID 122688679
1-[6,6-bis(1H-indol-6-yl)-5,5-bis[2-[4-[(3-methoxypyrrolidin-1-yl)methyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone (PubChem CID 122688679) has the molecular formula C58H54N4O4 and a molecular weight of 871.09 g/mol. Its IUPAC name is 1-[6,6-bis(1H-indol-6-yl)-5,5-bis[2-[4-[(3-methoxypyrrolidin-1-yl)methyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[6,6-bis(1H-indol-6-yl)-5,5-bis[2-[4-[(3-methoxypyrrolidin-1-yl)methyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 122688679 |
| Molecular Formula | C58H54N4O4 |
| Molecular Weight | 871.09 g/mol |
| Exact Mass | 870.41 |
| IUPAC Name | 1-[6,6-bis(1H-indol-6-yl)-5,5-bis[2-[4-[(3-methoxypyrrolidin-1-yl)methyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone |
| SMILES | COC1CCN(Cc2ccc(C#CC3(C#Cc4ccc(CN5CCC(OC)C5)cc4)C=CC=C(C(=O)C(O)c4ccccc4)C3(c3ccc4cc[nH]c4c3)c3ccc4cc[nH]c4c3)cc2)C1 |
| InChI | InChI=1S/C58H54N4O4/c1-65-50-26-33-61(39-50)37-43-14-10-41(11-15-43)22-29-57(30-23-42-12-16-44(17-13-42)38-62-34-27-51(40-62)66-2)28-6-9-52(56(64)55(63)47-7-4-3-5-8-47)58(57,48-20-18-45-24-31-59-53(45)35-48)49-21-19-46-25-32-60-54(46)36-49/h3-21,24-25,28,31-32,35-36,50-51,55,59-60,63H,26-27,33-34,37-40H2,1-2H3 |
| InChIKey | OSUXENGXTWSDJT-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.09 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|