C60H50F2N6O4 — CID 122688796
1-[5,5-bis[2-[7-fluoro-3-(morpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]-6,6-bis(1H-indol-6-yl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone (PubChem CID 122688796) has the molecular formula C60H50F2N6O4 and a molecular weight of 957.09 g/mol. Its IUPAC name is 1-[5,5-bis[2-[7-fluoro-3-(morpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]-6,6-bis(1H-indol-6-yl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | 1-[5,5-bis[2-[7-fluoro-3-(morpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]-6,6-bis(1H-indol-6-yl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 122688796 |
| Molecular Formula | C60H50F2N6O4 |
| Molecular Weight | 957.09 g/mol |
| Exact Mass | 956.39 |
| IUPAC Name | 1-[5,5-bis[2-[7-fluoro-3-(morpholin-4-ylmethyl)-1H-indol-6-yl]ethynyl]-6,6-bis(1H-indol-6-yl)cyclohexa-1,3-dien-1-yl]-2-hydroxy-2-phenylethanone |
| SMILES | O=C(C1=CC=CC(C#Cc2ccc3c(CN4CCOCC4)c[nH]c3c2F)(C#Cc2ccc3c(CN4CCOCC4)c[nH]c3c2F)C1(c1ccc2cc[nH]c2c1)c1ccc2cc[nH]c2c1)C(O)c1ccccc1 |
| InChI | InChI=1S/C60H50F2N6O4/c61-53-41(10-14-48-44(35-65-55(48)53)37-67-25-29-71-30-26-67)16-21-59(22-17-42-11-15-49-45(36-66-56(49)54(42)62)38-68-27-31-72-32-28-68)20-4-7-50(58(70)57(69)43-5-2-1-3-6-43)60(59,46-12-8-39-18-23-63-51(39)33-46)47-13-9-40-19-24-64-52(40)34-47/h1-15,18-20,23-24,33-36,57,63-66,69H,25-32,37-38H2 |
| InChIKey | IRGMNCQQTRVJKE-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.09 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|