C29H28FN4O4+ — CID 122688857
5-(3,5-dimethyl-1,2-oxazol-4-yl)-8-[(4-fluorophenyl)-(oxan-4-yl)methyl]-8-methyl-3,12-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-11-carboxylic acid (PubChem CID 122688857) has the molecular formula C29H28FN4O4+ and a molecular weight of 515.57 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-8-[(4-fluorophenyl)-(oxan-4-yl)methyl]-8-methyl-3,12-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-11-carboxylic acid.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-8-[(4-fluorophenyl)-(oxan-4-yl)methyl]-8-methyl-3,12-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-11-carboxylic acid |
|---|---|
| PubChem CID | 122688857 |
| Molecular Formula | C29H28FN4O4+ |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-8-[(4-fluorophenyl)-(oxan-4-yl)methyl]-8-methyl-3,12-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-11-carboxylic acid |
| SMILES | Cc1noc(C)c1-c1cnc2c(c1)[N+](C)(C(c1ccc(F)cc1)C1CCOCC1)c1cc(C(=O)O)ncc1-2 |
| InChI | InChI=1S/C29H27FN4O4/c1-16-26(17(2)38-33-16)20-12-25-27(32-14-20)22-15-31-23(29(35)36)13-24(22)34(25,3)28(19-8-10-37-11-9-19)18-4-6-21(30)7-5-18/h4-7,12-15,19,28H,8-11H2,1-3H3/p+1 |
| InChIKey | CBCWUWHGZPEHTA-UHFFFAOYSA-O |
| XLogP | 6.00 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|