C33H32F7N3O5 — CID 122689672
(4S)-4-[[(2S)-2-[[3-(3,5-difluorophenyl)-3-(4-methoxyphenyl)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 122689672) has the molecular formula C33H32F7N3O5 and a molecular weight of 683.62 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[3-(3,5-difluorophenyl)-3-(4-methoxyphenyl)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-2-[[3-(3,5-difluorophenyl)-3-(4-methoxyphenyl)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 122689672 |
| Molecular Formula | C33H32F7N3O5 |
| Molecular Weight | 683.62 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[3-(3,5-difluorophenyl)-3-(4-methoxyphenyl)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | COc1ccc(C(CC(=O)N[C@H](C(=O)N[C@H](C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(C)C)c2ccccc2)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C33H32F7N3O5/c1-18(2)27(29(45)33(39,40)31(47)41-17-32(36,37)38)43-30(46)28(20-7-5-4-6-8-20)42-26(44)16-25(19-9-11-24(48-3)12-10-19)21-13-22(34)15-23(35)14-21/h4-15,18,25,27-28H,16-17H2,1-3H3,(H,41,47)(H,42,44)(H,43,46)/t25?,27-,28-/m0/s1 |
| InChIKey | AHDQFFHTIZNTLN-UXXOXOCRSA-N |
| XLogP | 5.38 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|