About (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine
(3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine (PubChem CID 122689841) has the molecular formula C17H19BrFNO
and a molecular weight of 352.25 g/mol. Its IUPAC name is (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine.
Molecular Properties
| Compound Name | (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine |
| PubChem CID | 122689841 |
| Molecular Formula | C17H19BrFNO |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine |
| SMILES | Fc1ccc(C(C2CCOCC2)[C@H]2C=C(Br)C=NC2)cc1 |
| InChI | InChI=1S/C17H19BrFNO/c18-15-9-14(10-20-11-15)17(13-5-7-21-8-6-13)12-1-3-16(19)4-2-12/h1-4,9,11,13-14,17H,5-8,10H2/t14-,17?/m0/s1 |
| InChIKey | KQELGQZWKKPFKH-MBIQTGHCSA-N |
| XLogP | 4.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine?
The IUPAC name of (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine (CID 122689841) is (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine.
What is the SMILES notation for (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine?
The canonical SMILES for (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine is Fc1ccc(C(C2CCOCC2)[C@H]2C=C(Br)C=NC2)cc1.
What is the InChIKey of (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine?
The InChIKey is KQELGQZWKKPFKH-MBIQTGHCSA-N. The full InChI is InChI=1S/C17H19BrFNO/c18-15-9-14(10-20-11-15)17(13-5-7-21-8-6-13)12-1-3-16(19)4-2-12/h1-4,9,11,13-14,17H,5-8,10H2/t14-,17?/m0/s1.
What are the key properties of (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine?
(3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine has a molecular weight of 352.25 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-bromo-3-[(4-fluorophenyl)-(oxan-4-yl)methyl]-2,3-dihydropyridine is sourced from PubChem (CID 122689841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).