C21H26N4 — CID 122690041
(1R,9R,10R)-17-methyl-N-pyrimidin-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 122690041) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is (1R,9R,10R)-17-methyl-N-pyrimidin-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-methyl-N-pyrimidin-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 122690041 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | (1R,9R,10R)-17-methyl-N-pyrimidin-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(Nc2ncccn2)cc13 |
| InChI | InChI=1S/C21H26N4/c1-25-12-9-21-8-3-2-5-17(21)19(25)13-15-6-7-16(14-18(15)21)24-20-22-10-4-11-23-20/h4,6-7,10-11,14,17,19H,2-3,5,8-9,12-13H2,1H3,(H,22,23,24)/t17-,19+,21+/m0/s1 |
| InChIKey | HZXNFFUIEXCYPN-FBBABVLZSA-N |
| XLogP | 3.91 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |