C24H36N2O4 — CID 122690090
2-[2-(2-methoxyethoxy)ethoxy]-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetamide (PubChem CID 122690090) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetamide.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 122690090 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetamide |
| SMILES | COCCOCCOCC(=O)Nc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C24H36N2O4/c1-26-10-9-24-8-4-3-5-20(24)22(26)15-18-6-7-19(16-21(18)24)25-23(27)17-30-14-13-29-12-11-28-2/h6-7,16,20,22H,3-5,8-15,17H2,1-2H3,(H,25,27)/t20-,22+,24+/m0/s1 |
| InChIKey | YLKHAAVXMAEWDZ-BGWNEDDSSA-N |
| XLogP | 2.99 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|