About 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione
1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione (PubChem CID 122690392) has the molecular formula C5H5FN2O3
and a molecular weight of 160.10 g/mol. Its IUPAC name is 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione |
| PubChem CID | 122690392 |
| Molecular Formula | C5H5FN2O3 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(F)cc1CO |
| InChI | InChI=1S/C5H5FN2O3/c6-8-1-3(2-9)4(10)7-5(8)11/h1,9H,2H2,(H,7,10,11) |
| InChIKey | GDRMMBBOSZSJLQ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione?
The IUPAC name of 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione (CID 122690392) is 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione?
The canonical SMILES for 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione is O=c1[nH]c(=O)n(F)cc1CO.
What is the InChIKey of 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione?
The InChIKey is GDRMMBBOSZSJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2O3/c6-8-1-3(2-9)4(10)7-5(8)11/h1,9H,2H2,(H,7,10,11).
What are the key properties of 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione?
1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione has a molecular weight of 160.10 g/mol, XLogP of -1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-5-(hydroxymethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 122690392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).