C21H29FN10O2 — CID 122690476
N-[(3R,4R)-1-[4-[[1-[2-(dimethylamino)ethyl]-3-methoxypyrazol-4-yl]amino]-7-methylimidazo[2,1-f][1,2,4]triazin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide (PubChem CID 122690476) has the molecular formula C21H29FN10O2 and a molecular weight of 472.53 g/mol. Its IUPAC name is N-[(3R,4R)-1-[4-[[1-[2-(dimethylamino)ethyl]-3-methoxypyrazol-4-yl]amino]-7-methylimidazo[2,1-f][1,2,4]triazin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4R)-1-[4-[[1-[2-(dimethylamino)ethyl]-3-methoxypyrazol-4-yl]amino]-7-methylimidazo[2,1-f][1,2,4]triazin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122690476 |
| Molecular Formula | C21H29FN10O2 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[(3R,4R)-1-[4-[[1-[2-(dimethylamino)ethyl]-3-methoxypyrazol-4-yl]amino]-7-methylimidazo[2,1-f][1,2,4]triazin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CN(c2nc(Nc3cn(CCN(C)C)nc3OC)c3ncc(C)n3n2)C[C@H]1F |
| InChI | InChI=1S/C21H29FN10O2/c1-6-17(33)24-15-11-30(10-14(15)22)21-26-18(19-23-9-13(2)32(19)28-21)25-16-12-31(8-7-29(3)4)27-20(16)34-5/h6,9,12,14-15H,1,7-8,10-11H2,2-5H3,(H,24,33)(H,25,26,28)/t14-,15-/m1/s1 |
| InChIKey | VLYAFXURGVQMKH-HUUCEWRRSA-N |
| XLogP | 0.77 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|